Oppland, Norwayi
| Regional Level Types | |
|---|---|
| Oppland | County (Former) |
| Norway | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
County (Former) - last checked 2020
Other Languages:
French:
Oppland, Norvège
German:
Oppland, Norwegen
Italian:
Oppland, Norvegia
Russian:
Оппланн, Норвегия
Simplified Chinese:
奥普兰, 挪威
Spanish:
Oppland, Noruega
Afrikaans:
Oppland, Noorweë
Albanian:
Oppland, Norvegjia
Arabic:
أوبلاند, النرويج
Armenian:
Օփլան, Նորվեգիա
Asturian:
Oppland, Noruega
Basque:
Oppland, Norvegia
Bavarian:
Oppland, Norwegn
Belarusian:
Оплан, Нарвегія
Belarusian (Tarashkevitsa):
Оплан, Нарвэгія
Bengali:
অপল্যান্ড, নরওয়ে
Bishnupriya Manipuri:
ওপল্যান্ড, নরৱে
Bosnian:
Oppland, Norveška
Breton:
Oppland, Norvegia
Bulgarian:
Оплан, Норвегия
Catalan:
Oppland, Noruega
Cebuano:
Oppland fylke, Norway
Cornish:
Oppland, Norgagh
Croatian:
Oppland, Norveška
Czech:
Oppland, Norsko
Danish:
Oppland, Norge
Dutch:
Oppland, Noorwegen
Esperanto:
Oppland, Norvegio
Estonian:
Oppland, Norra
Faroese:
Oppland fylke, Noreg
Farsi/Persian:
اوپلاند , نروژ
Finnish:
Opplandin lääni, Norja
Georgian:
ოპლანი, ნორვეგია
Greek:
Όπλαντ, Νορβηγία
Gujarati:
ઓપ્પલેન્ડ, નોર્વે
Hebrew:
אופלנד , נורבגיה
Hindi:
ओपलैंड, नॉर्वे
Hungarian:
Oppland megye, Norvégia
Icelandic:
Upplönd, Noregur
Indonesian:
Oppland, Norwegia
Japanese:
オップラン県, ノルウェー
Kannada:
ಆಪ್ಲಾಂಡ್, ಕಾಮೌ
Korean:
오플란주, 노르웨이
Latin:
Oppland, Norvegia
Latvian:
Oplanne, Norvēģija
Limburgian:
Oppland, Noorwege
Lithuanian:
Oplandas, Norvegija
Low Saxon/Low German:
Amt Oppland, Norwegen
Macedonian:
Оплан, Норвешка
Malay:
Oppland, Norway
Marathi:
ऑप्पलँड, नॉर्वे
Minnan / Hokkien-Taiwanese:
Oppland, Lo̍k-ui
Nauruan:
Oppland, Norwei
Northern Sami:
Opplándda fylka, Norga
Norwegian:
Oppland, Norge
Norwegian (Nynorsk):
Oppland fylke, Noreg
Occitan:
Oppland, Norvègia
Ossetian:
Опланн, Норвеги
Pashto:
اوپلاند , ناروې
Polish:
Oppland, Norwegia
Portuguese:
Oppland, Noruega
Romanian:
Oppland, Norvegia
Samogitian:
Uoplands, Nuorvegėjė
Scots:
Oppland, Norawa
Serbian:
Опланд, Норвешка
Serbo-Croatian:
Oppland, Norveška
Sinhalese:
ඔප්ලන්ඩ්, නෝර්වේ
Slovak:
Oppland, Nórsko
Slovenian:
Oppland, Norveška
South Azerbaijani:
اوپلاند, نوروژ
Swahili:
Oppland, Norwei
Swedish:
Oppland, Norge
Tamil:
ஒப்பிலான்ட், நோர்வே
Telugu:
ఆప్లాండ్, నార్వే
Thai:
เทศบาลเมืองโคการ์, นอร์เวย์
Turkish:
Oppland, Norveç
Ukrainian:
Опплан, Норвегія
Urdu:
اوپلان, ناروے
Vietnamese:
Oppland, Na Uy
Waray:
Oppland, Noruega
Western Punjabi:
اوپلینڈ, ناروے
Wu Chinese:
奥普兰, 挪威
The Oppland county was merged with Hedmark county into the new Innlandet county 1.1.2020.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities216 valid minerals. 4 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Aegirine Formula: NaFe3+Si2O6 |
| ⓘ Aegirine-augite ? Formula: (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 Locality: Vassbråa, Gran, Innlandet, Norway |
| ⓘ 'Aeschynite' |
| ⓘ Alamosite Formula: PbSiO3 |
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 19 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O Localities: Colour: Brownish red Description: wax-like (X-ray amorphous materiale) |
| ⓘ Allophane var. Cupro-Allophane Formula: (Al2O3)(SiO2)1.3-2 · 2.5-3H2O References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Amarantite Formula: Fe3+2(SO4)2O · 7H2O |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 Localities: Reported from at least 12 localities in this region. |
| ⓘ 'Amphibole Supergroup var. Uralite' Formula: AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 Localities: Reported from at least 32 localities in this region. Description: Small crystals (< 1mm) in pseudomorphoses after a Ti-mineral (narsarsukite?) |
| ⓘ Ancylite-(Ce) Formula: CeSr(CO3)2(OH) · H2O |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 Localities: Reported from at least 7 localities in this region. Habit: massive Colour: yellow to brown Description: Mn-rich. Intergrown with rhodonite |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Anorthite ? Formula: Ca(Al2Si2O8) |
| ⓘ Anorthite var. Labradorite ? Formula: (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O22]X · 8H2O Localities: Reported from at least 6 localities in this region. |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F Locality: Gjerdingselva, Lunner, Akershus, Norway - erroneously reported Description: Reported in Raade & Haug (1980), but later shown to be kupletskite References: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH Description: The mineral was first found by Hans Christian Olsen and identified by SEM/EDS and PXRD ved Naturhistorisk museum in Oslo |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 Localities: Habit: microcrystals Colour: blue |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Baryte Formula: BaSO4 Localities: Reported from at least 10 localities in this region. |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Localities: Habit: Yellow spherulites Description: Also as pseudomorphs after an octahedral pyrochlore group mineral and as pseudomorphs after flattened dipyramidal zircon crystals |
| ⓘ Bazzite Formula: Be3Sc2(Si6O18) |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 Locality: Roadcut Lom, Lom, Innlandet, Norway |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Birnessite Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| ⓘ Bornite Formula: Cu5FeS4 Localities: Reported from at least 6 localities in this region. |
| ⓘ Braunite Formula: Mn2+Mn3+6(SiO4)O8 |
| ⓘ Brewsterite-Ba Formula: Ba(Al2Si6)O16 · 5H2O Locality: Åmot, Sjoa, Sel, Innlandet, Norway Description: Up to 3mm broad waterclear crystals. The crystals are stronlgy zonated with brewsterite-Ba in the rims and strontian brewsterite-Ba between the rim and the core, and with a core of brewsterite-Sr. |
| ⓘ Brewsterite-Sr Formula: Sr(Al2Si6)O16 · 5H2O Locality: Åmot, Sjoa, Sel, Innlandet, Norway Description: Up to 3mm broad waterclear crystals. The crystals are stronlgy zonated with brewsterite-Ba in the rims and strontian brewsterite-Ba between the rim and the core, and with a core of brewsterite-Sr |
| ⓘ 'Brewsterite Subgroup' Locality: Sjoa, Sel, Innlandet, Norway |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 Localities: Reported from at least 10 localities in this region. Description: Occure usually in pseudomorphoses after a Ti mineral (narsarsukite?), as small black crystals together with anatase and elpidite. |
| ⓘ Calcite Formula: CaCO3 Localities: Reported from at least 28 localities in this region. |
| ⓘ Catapleiite ? Formula: Na2Zr(Si3O9) · 2H2O Locality: Gjerdingselva, Lunner, Akershus, Norway Description: Raade & Haug (1980): "The presence of titanite, catapleiite and zeophyllite as reported by Dietrich et al. (1965) has not been confirmed by us." References: |
| ⓘ Cerianite-(Ce) ? Formula: (Ce4+,Th)O2 Locality: Gjerdingselva, Lunner, Akershus, Norway Description: According to (Neumann 1985) Kristiansen reports having found cerianite-(Ce) in a caviety in elpidite-ekerite at Gjerdingen. The mineral sample was completely used for identification (XRD only). Identification doubtful. |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ 'Chabazite' Localities: Reported from at least 6 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 18 localities in this region. |
| ⓘ Chevkinite-(Ce) Formula: Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ 'Chevkinite Group' ? |
| ⓘ 'Chlorite Group' Localities: Reported from at least 24 localities in this region. |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Chrysotile Formula: Mg3(Si2O5)(OH)4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinochlore var. Chromium-bearing Clinochlore Formula: Mg5(Al,Cr)2Si3O10(OH)8 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ 'Clinopyroxene Subgroup' Localities: Reported from at least 7 localities in this region. |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Cobaltpentlandite Formula: Co9S8 |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Localities: Habit: As starlike twins (trilling) up to 1mm Description: Found in one sample as a starlike aggregate(trilling) up to 1mm, probably an epitaxial growth on a unidentified mineral (Raade 1982) |
| ⓘ Copiapite Formula: Fe2+Fe3+4(SO4)6(OH)2 · 20H2O Locality: Hjerkinn, Dovre, Innlandet, Norway |
| ⓘ Cordierite Formula: (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cosalite Formula: Pb2Bi2S5 |
| ⓘ Covellite Formula: CuS |
| ⓘ Cryolite Formula: Na2NaAlF6 Locality: Gjerdingselva, Lunner, Akershus, Norway Description: Found in one piece only (K.Eldjarn collection) |
| ⓘ Cubanite ? Formula: CuFe2S3 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Cyanotrichite Formula: Cu4Al2(SO4)(OH)12 · 2H2O References: |
| ⓘ Dalyite Formula: K2ZrSi6O15 Locality: Gjerdingselva, Lunner, Akershus, Norway Description: Typically found in close contact with janhaugite. |
| ⓘ Daubréelite Formula: Fe2+Cr3+2S4 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Doyleite Formula: Al(OH)3 Locality: Gjerdingselva, Lunner, Akershus, Norway References: |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Elpidite Formula: Na2ZrSi6O15 · 3H2O Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Elpidite var. Calcium-bearing Elpidite Formula: (Na,Ca)2ZrSi6O15 · 3H2O Locality: Gjerdingselva, Lunner, Akershus, Norway References: |
| ⓘ Epididymite Formula: Na2Be2Si6O15 · H2O Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Localities: Reported from at least 18 localities in this region. |
| ⓘ Epsomite Formula: MgSO4 · 7H2O Habit: fibrous coating Colour: white Description: XRD-film nr 28653, MGM, Oslo References: |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ 'Feldspar Group' Localities: Reported from at least 15 localities in this region. |
| ⓘ 'Feldspar Group var. Cryptoperthite' Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ 'Feldspar Group var. Perthite' Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ 'Fergusonite' Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorapatite var. Carbonate-rich Fluorapatite Formula: Ca5(PO4,CO3)3(F,O) Habit: Masses and elongated crystals Colour: Greyish-blue with a brownish alteration Description: 1-5 mm roundes masses in feldspar |
| ⓘ Fluorapophyllite-(K) Formula: KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ Fluorite Formula: CaF2 Localities: Reported from at least 12 localities in this region. Habit: octahedron faces dominant or more complex formes Colour: violet; colorless |
| ⓘ Fluorphosphohedyphane Formula: Ca2Pb3(PO4)3F |
| ⓘ Forsterite Formula: Mg2SiO4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ⓘ Forsterite var. Peridot Formula: Mg2SiO4 Locality: Framruste, Skjåk, Innlandet, Norway |
| ✪ Gagarinite-(Y) Formula: NaCaYF6 Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: tabular, long to short prismatic; hexagonal prisms; often not terminated xls Colour: Pale rose; colorless Description: Commonly in association with monazite-(Ce) |
| ⓘ Gahnite ? Formula: ZnAl2O4 Description: Not confirmed by XRD |
| ⓘ Galena Formula: PbS Localities: Reported from at least 16 localities in this region. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 Localities: Reported from at least 12 localities in this region. |
| ⓘ Gearksutite Formula: Ca[Al(F,OH)5(H2O)] Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: chalk-like masses Colour: white to light rose Description: Occure as white, chalky masses filling cavities, consisting of submicroscopic platy-crystals. References: |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Gjerdingenite-Fe (TL) Formula: K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O Type Locality: |
| ⓘ Gjerdingenite-Mn (TL) Formula: K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O Type Locality: References: Raade, Gunnar, Chukanov, Nikita V., Kolitsch, Uwe, Möckel, Steffen, Zadov, Aleksandr E., Pekov, Igor V. (2004) Gjerdingenite-Mn from Norway a new mineral species in the labuntsovite group: descriptive data and crystal structure. European Journal of Mineralogy, 16 (6) 979-987 doi:10.1127/0935-1221/2004/0016-0979 |
| ⓘ Goethite Formula: Fe3+O(OH) Localities: Reported from at least 12 localities in this region. Description: Nice velvet-coatings and spherules of goethite crystals on quartz crystals. |
| ⓘ Goosecreekite Formula: Ca[Al2Si6O16] · 5H2O Locality: Juvvatn, Lom, Innlandet, Norway References: |
| ⓘ Goslarite Formula: ZnSO4 · 7H2O |
| ⓘ Graphite Formula: C |
| ⓘ Greenockite Formula: CdS |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 Localities: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Localities: Reported from at least 9 localities in this region. |
| ⓘ Halotrichite Formula: FeAl2(SO4)4 · 22H2O Localities: Colour: orange-yellow Description: Concretions formed by alteration of precambrian black pyritic shale |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 Localities: |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S |
| ⓘ Hematite Formula: Fe2O3 Localities: Reported from at least 29 localities in this region. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O Localities: |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Hetaerolite Formula: ZnMn2O4 Description: NHM, Oslo XRD / SEM-EDS |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 Description: NHM, Oslo XRD / SEM-EDS
Hydrohetaerolite was discredited as a mineral species in 2018. |
| ⓘ Heulandite-Ba Formula: (Ba,Ca,K)5(Si27Al9)O72 · 22H2O Locality: Åmot, Sjoa, Sel, Innlandet, Norway |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Heulandite-Sr Formula: (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O Locality: Sjoa, Sel, Innlandet, Norway |
| ⓘ 'Heulandite Subgroup' Formula: (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ Hexahydrite Formula: MgSO4 · 6H2O |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Hydrokenoralstonite Formula: Na0.5(Al,Mg)2(F,OH)6 · H2O Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: Masses filling interstices between feldspar xls; Botryoidal growths (white); Microcrystalline coatings on other minerals (Cubes and octahedras). Colour: Green, white and colourless. Description: Usually as green masses, consisting of submicroscopic crystals. Also as clear/white sugar-like coating in cavities. Rarely as up to 1 mm sized cubic or octahedral crystals. References: |
| ⓘ Hydrotungstite Formula: WO3 · 2H2O Description: NHM, Oslo XRD / SEM-EDS |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Reported from at least 11 localities in this region. Description: Butler, J.R. (1954): The geochemistry and mineralogy of rock weathering. (2). The Nordmarka area, Oslo. Geochimica et Cosmochimica Acta, 6, p. 268-281
|
| ⓘ Ilvaite Formula: CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ Janhaugite (TL) Formula: (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 Type Locality: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kaersutite Formula: NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Kentrolite Formula: Pb2Mn3+2(Si2O7)O2 Description: Small, brownish spherulites with a radial structure up to 0.5 mm |
| ⓘ 'K Feldspar' Localities: Reported from at least 8 localities in this region. |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Localities: Reported from at least 8 localities in this region. |
| ⓘ Kupletskite Formula: K2NaMn2+7Ti2[Si4O12]2O2(OH)4F Locality: Gjerdingselva, Lunner, Akershus, Norway References: |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) Description: Occur in the alteration product of biotite in the nordmarkite. |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lorenzenite Formula: Na2Ti2(Si2O6)O3 Locality: Gjerdingselva, Lunner, Akershus, Norway References: |
| ⓘ Magnesite Formula: MgCO3 Localities: Reported from at least 8 localities in this region. |
| ⓘ Magnesite var. Breunnerite Formula: (Mg,Fe)CO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Reported from at least 25 localities in this region. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 Habit: Powdery, earthy masses Colour: Brown-yellowish |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Mendozite Formula: NaAl(SO4)2 · 11H2O |
| ⓘ 'Mica Group' Locality: Dragå Prospect, Dovre, Innlandet, Norway |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ Millerite Formula: NiS References: |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) Localities: Reported from at least 11 localities in this region. |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 11 localities in this region. |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ 'Muscovite-1M' Formula: KAl2(AlSi3O10)(OH)2 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Narsarsukite Formula: Na2(Ti,Fe3+)Si4(O,F)11 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Iron Formula: Fe |
| ⓘ Native Iron var. Kamacite Formula: (Fe,Ni) |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Natrolite Formula: Na2Al2Si3O10 · 2H2O |
| ⓘ Neighborite Formula: NaMgF3 Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: simple cubelike, more or less elongated crystals Colour: colorless to pale brownish Description: Neighborite is only found in a fine grained variety of the ekerite rock.
NB: Difficult in some cases to distinguish from pale brownish cleavages of rhodochrosite |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Osarizawaite Formula: Pb(Al2Cu2+)(SO4)2(OH)6 Colour: yellowgreen |
| ⓘ Pachnolite Formula: NaCa[AlF6] · H2O Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: Columnar crystals with basal termination. Forms clusters with a network structure with 2 different orientations of the crystals at right angles. Basal pinacoid {001} and prism {110} Colour: white |
| ⓘ Paragonite Formula: NaAl2(AlSi3O10)(OH)2 |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Pentlandite (TL) Formula: (NixFey)Σ9S8 Localities: Reported from at least 6 localities in this region. Type Locality: Espedalen mines, Gausdal, Innlandet, Norway Description: Scheerer (1843) describe a new mineral from Lillehammer, Norway, from samples he received from A. Johansen. [The label of the original piecs says Gausdal, presumably the Espedalen mines in Gausdal). He named the mineral Eisennickelkies/Jern-Nikkelkiis. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 Localities: Habit: Platy mica aggregates Description: Polytype 2M1 |
| ⓘ 'Phlogopite-2M1' Formula: KMg3(AlSi3O10)(OH)2 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Phosphohedyphane Formula: Ca2Pb3(PO4)3Cl |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ 'Psilomelane' References: |
| ⓘ 'Pumpellyite Subgroup' Formula: Ca2XAl2[Si2O6(OH)][SiO4](OH)2A Locality: Veti Glacier, Lom, Innlandet, Norway |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 42 localities in this region. |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Localities: Reported from at least 6 localities in this region. Description: A pyrochlore crystal is analyzed and show to consist of plumbopyrochlore annd ceriopyrochlore-(Ce) (Raade 2009) |
| ⓘ 'Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977)' Formula: A2Nb2(O,OH)6Z Locality: Gjerdingselva, Lunner, Akershus, Norway Description: BSE-images and EMP analysis of a crystal of a pyrochlore group minera showed that the crystal consisted of ceriopyrochlore-(Y) as the central part and plumbopyrochlore as the outer rim (Raade 2009). |
| ⓘ 'Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.)' Formula: A2Nb2(O,OH)6Z Locality: Gjerdingselva, Lunner, Akershus, Norway Description: Found in one crystals BSE-images and EMP analysis showed that the crystal consisted of ceriopyrochlore-(Y) as the central part and plumbopyrochlore as the outer rim (Raade 2009) |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrophanite Formula: Mn2+TiO3 Localities: Reported from at least 7 localities in this region. |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Reported from at least 16 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 65 localities in this region. |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rhodochrosite Formula: MnCO3 Localities: Colour: pale brownish Description: Occurs sometimes together with neighborite (Raade & Haug 1980) |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Rutile Formula: TiO2 Localities: Reported from at least 19 localities in this region. |
| ⓘ Rutile var. Niobium-bearing Rutile Formula: (Ti,Nb)O2 Locality: Gjerdingselva, Lunner, Akershus, Norway |
| ⓘ Rutile var. Sagenite (of Saussure) Formula: TiO2 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ Saponite Formula: Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ 'Scapolite' Localities: Nyseter Zinc Mines, Grua mining district, Grua, Lunner, Akershus, Norway Østhagan Iron and Limestone Mines, Grua mining district, Grua, Lunner, Akershus, Norway Totenåsen, Østre Toten, Innlandet, Norway Kalkovnen, Østhagan Nature Reserve, Grua mining district, Grua, Lunner, Akershus, Norway Raudalsvatnet, Skjåk, Innlandet, Norway |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schreibersite Formula: (Fe,Ni)3P |
| ⓘ Scolecite Formula: CaAl2Si3O10 · 3H2O |
| ⓘ Sellaite Formula: MgF2 Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: masses; rough crystals in the form of a flat tetragonal bipyramids Colour: white Description: Found as nice colourless crystals in miarolitic cavities. |
| ⓘ Sepiolite Formula: Mg4(Si6O15)(OH)2 · 6H2O Locality: Mugnetind, Vang, Innlandet, Norway |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Slavíkite Formula: (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ 'Soapstone' |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 16 localities in this region. Habit: singel & twin crystals Colour: yellow, dark redbrown |
| ⓘ Stellerite ? Formula: Ca4(Si28Al8)O72 · 28H2O Locality: Juvvatn, Lom, Innlandet, Norway References: |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O Localities: Reported from at least 16 localities in this region. |
| ⓘ Stilpnomelane Formula: (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ Stolzite Formula: Pb(WO4) |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ Synchysite-(Ce) Formula: CaCe(CO3)2F |
| ⓘ Taenite Formula: (Fe,Ni) |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Tenorite Formula: CuO |
| ⓘ Tetradymite Formula: Bi2Te2S |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ Thomsenolite Formula: NaCa[AlF6] · H2O Locality: Gjerdingselva, Lunner, Akershus, Norway Habit: Groups of tabular xls with prism {110} and basal pinacoid {001} Colour: white Description: Occure as tabular, white crystals, often associated with younger ralstonite. |
| ⓘ Thorite Formula: Th(SiO4) Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ Thorite var. Orangite Formula: Th(SiO4) Locality: Byrtnes, Lom, Innlandet, Norway |
| ⓘ Titanite Formula: CaTi(SiO4)O Localities: Reported from at least 18 localities in this region. |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O Locality: Fåberg, Lillehammer, Innlandet, Norway References: |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Localities: Reported from at least 7 localities in this region. |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Troilite Formula: FeS |
| ⓘ Ulvöspinel Formula: TiFe2+2O4 Description: Kristoffersen (1973) found small amounts of ulvöspinel with ilmenite in a larvikite-rock SW of Gjerdingen. |
| ⓘ Uvarovite Formula: Ca3Cr2(SiO4)3 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) Localities: Reported from at least 6 localities in this region. Habit: Dipyramidal Description: Astrid Haugen has found a dipyramidal crystal of wulfenite. The specimen was given to the Gjerdingen reference collection in the Mineralogical Museum in Oslo. |
| ⓘ Zeophyllite ? Formula: Ca13Si10O28(OH)2F8 · 6H2O Locality: Gjerdingselva, Lunner, Akershus, Norway Description: Raade & Haug (1980): "The presence of titanite, catapleiite and zeophyllite as reported by Dietrich et al. (1965) has not been confirmed by us." References: |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 13 localities in this region. |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) Locality: Store Memurutind, Lom, Innlandet, Norway |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) Localities: Reported from at least 7 localities in this region. |
| ⓘ Zoisite var. Thulite Formula: {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | var. Kamacite | 1.AE.05 | (Fe,Ni) |
| ⓘ | Taenite | 1.AE.10 | (Fe,Ni) |
| ⓘ | Schreibersite | 1.BD.05 | (Fe,Ni)3P |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Cobaltpentlandite | 2.BB.15 | Co9S8 |
| ⓘ | Pentlandite (TL) | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Cubanite ? | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Troilite | 2.CC.10 | FeS |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Daubréelite | 2.DA.05 | Fe2+Cr3+2S4 |
| ⓘ | Tetradymite | 2.DC.05 | Bi2Te2S |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Cosalite | 2.JB.10 | Pb2Bi2S5 |
| Group 3 - Halides | |||
| ⓘ | Neighborite | 3.AA.35 | NaMgF3 |
| ⓘ | Sellaite | 3.AB.15 | MgF2 |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Gagarinite-(Y) | 3.AB.35 | NaCaYF6 |
| ⓘ | Cryolite | 3.CB.15 | Na2NaAlF6 |
| ⓘ | Pachnolite | 3.CB.40 | NaCa[AlF6] · H2O |
| ⓘ | Thomsenolite | 3.CB.40 | NaCa[AlF6] · H2O |
| ⓘ | Gearksutite | 3.CC.05 | Ca[Al(F,OH)5(H2O)] |
| ⓘ | Hydrokenoralstonite | 3.CF.05 | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.)' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | '' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite ? | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ulvöspinel | 4.BB.05 | TiFe2+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Niobium-bearing Rutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Cerianite-(Ce) ? | 4.DL.05 | (Ce4+,Th)O2 |
| ⓘ | Doyleite | 4.FE.10 | Al(OH)3 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Hydrotungstite | 4.FJ.15 | WO3 · 2H2O |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Birnessite | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Magnesite var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Ancylite-(Ce) | 5.DC.05 | CeSr(CO3)2(OH) · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Osarizawaite | 7.BC.10 | Pb(Al2Cu2+)(SO4)2(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Hexahydrite | 7.CB.25 | MgSO4 · 6H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Epsomite | 7.CB.40 | MgSO4 · 7H2O |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Halotrichite | 7.CB.85 | FeAl2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Mendozite | 7.CC.15 | NaAl(SO4)2 · 11H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Amarantite | 7.DB.30 | Fe3+2(SO4)2O · 7H2O |
| ⓘ | Copiapite | 7.DB.35 | Fe2+Fe3+4(SO4)6(OH)2 · 20H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Cyanotrichite | 7.DE.10 | Cu4Al2(SO4)(OH)12 · 2H2O |
| ⓘ | Slavíkite | 7.DF.30 | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Fluorapatite var. Carbonate-rich Fluorapatite | 8.BN.05 | Ca5(PO4,CO3)3(F,O) |
| ⓘ | 8.BN.05 | Ca5(PO4)3F | |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| ⓘ | Fluorphosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | var. Peridot | 9.AC.05 | Mg2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Uvarovite | 9.AD.25 | Ca3Cr2(SiO4)3 |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Orangite | 9.AD.30 | Th(SiO4) |
| ⓘ | 9.AD.30 | Th(SiO4) | |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Braunite | 9.AG.05 | Mn2+Mn3+6(SiO4)O8 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Janhaugite (TL) | 9.BE.17 | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| ⓘ | Chevkinite-(Ce) | 9.BE.70 | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| ⓘ | Kentrolite | 9.BE.80 | Pb2Mn3+2(Si2O7)O2 |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite var. Thulite | 9.BG.10 | {Ca2}{Al,Mn3+3}(Si2O7)(SiO4)O(OH) |
| ⓘ | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) | |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Catapleiite ? | 9.CA.15 | Na2Zr(Si3O9) · 2H2O |
| ⓘ | Gjerdingenite-Fe (TL) | 9.CE.30c | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| ⓘ | Gjerdingenite-Mn (TL) | 9.CE.30c | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| ⓘ | Bazzite | 9.CJ.05 | Be3Sc2(Si6O18) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Cordierite | 9.CJ.10 | (Mg,Fe)2Al3(AlSi5O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Aegirine-augite ? | 9.DA.20 | (NaaCabFe2+cMgd)(Fe3+eAlfFe2+gMgh)Si2O6 |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Lorenzenite | 9.DB.10 | Na2Ti2(Si2O6)O3 |
| ⓘ | Astrophyllite ? | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Kupletskite | 9.DC.05 | K2NaMn2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Kaersutite | 9.DE.15 | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Epididymite | 9.DG.55 | Na2Be2Si6O15 · H2O |
| ⓘ | Elpidite | 9.DG.65 | Na2ZrSi6O15 · 3H2O |
| ⓘ | var. Calcium-bearing Elpidite | 9.DG.65 | (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ | Narsarsukite | 9.DJ.05 | Na2(Ti,Fe3+)Si4(O,F)11 |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Fluorapophyllite-(K) | 9.EA.15 | KCa4(Si8O20)(F,OH) · 8H2O |
| ⓘ | Dalyite | 9.EA.25 | K2ZrSi6O15 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Paragonite | 9.EC.15 | NaAl2(AlSi3O10)(OH)2 |
| ⓘ | Muscovite var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Saponite | 9.EC.45 | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | var. Chromium-bearing Clinochlore | 9.EC.55 | Mg5(Al,Cr)2Si3O10(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Allophane var. Cupro-Allophane | 9.ED.20 | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Sepiolite | 9.EE.25 | Mg4(Si6O15)(OH)2 · 6H2O |
| ⓘ | Zeophyllite ? | 9.EE.70 | Ca13Si10O28(OH)2F8 · 6H2O |
| ⓘ | Stilpnomelane | 9.EG.40 | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Anorthite ? | 9.FA.35 | Ca(Al2Si2O8) |
| ⓘ | var. Labradorite ? | 9.FA.35 | (Ca,Na)[Al(Al,Si)Si2O8] |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Natrolite | 9.GA.05 | Na2Al2Si3O10 · 2H2O |
| ⓘ | Scolecite | 9.GA.05 | CaAl2Si3O10 · 3H2O |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Goosecreekite | 9.GB.25 | Ca[Al2Si6O16] · 5H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ | Heulandite-Sr | 9.GE.05 | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| ⓘ | Heulandite-Ba | 9.GE.05 | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| ⓘ | Stellerite ? | 9.GE.15 | Ca4(Si28Al8)O72 · 28H2O |
| ⓘ | Brewsterite-Ba | 9.GE.20 | Ba(Al2Si6)O16 · 5H2O |
| ⓘ | Brewsterite-Sr | 9.GE.20 | Sr(Al2Si6)O16 · 5H2O |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Aeschynite' | - | |
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O22]X · 8H2O |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Brewsterite Subgroup' | - | |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Heulandite Subgroup' | - | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Pumpellyite Subgroup' | - | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Amphibole Supergroup var. Uralite' | - | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Feldspar Group var. Cryptoperthite' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'Soapstone' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Muscovite-1M' | - | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 'Phlogopite-2M1' | - | KMg3(AlSi3O10)(OH)2 |
| ⓘ | 'Chevkinite Group' ? | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| H | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| H | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Doyleite | Al(OH)3 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Epsomite | MgSO4 · 7H2O |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| H | ⓘ Hexahydrite | MgSO4 · 6H2O |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Hydrotungstite | WO3 · 2H2O |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| H | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| H | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| H | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Rozenite | FeSO4 · 4H2O |
| H | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| H | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| H | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| H | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| H | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zeophyllite | Ca13Si10O28(OH)2F8 · 6H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| H | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| H | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| H | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| H | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| H | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Bazzite | Be3Sc2(Si6O18) |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| O | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| O | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| O | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| O | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| O | ⓘ Dalyite | K2ZrSi6O15 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Doyleite | Al(OH)3 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Epsomite | MgSO4 · 7H2O |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| O | ⓘ Hexahydrite | MgSO4 · 6H2O |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Hydrotungstite | WO3 · 2H2O |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| O | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| O | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| O | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| O | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Thorite var. Orangite | Th(SiO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| O | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| O | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rozenite | FeSO4 · 4H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| O | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| O | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Ulvöspinel | TiFe22+O4 |
| O | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zeophyllite | Ca13Si10O28(OH)2F8 · 6H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| O | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| O | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| O | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| O | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| O | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| O | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| O | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| O | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| O | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| O | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| F | ⓘ Cryolite | Na2NaAlF6 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Gagarinite-(Y) | NaCaYF6 |
| F | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| F | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| F | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| F | ⓘ Neighborite | NaMgF3 |
| F | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| F | ⓘ Sellaite | MgF2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| F | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Zeophyllite | Ca13Si10O28(OH)2F8 · 6H2O |
| F | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Na | ⓘ Cryolite | Na2NaAlF6 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Na | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Na | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Na | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Na | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Na | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Na | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Na | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| Na | ⓘ Neighborite | NaMgF3 |
| Na | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Na | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Na | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Na | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Na | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Epsomite | MgSO4 · 7H2O |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Hexahydrite | MgSO4 · 6H2O |
| Mg | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Mg | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ Neighborite | NaMgF3 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Mg | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Mg | ⓘ Sellaite | MgF2 |
| Mg | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Mg | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Mg | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Mg | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Al | ⓘ Cryolite | Na2NaAlF6 |
| Al | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Al | ⓘ Doyleite | Al(OH)3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Al | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Al | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Al | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Al | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Al | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Al | ⓘ Hydrokenoralstonite | Na0.5(Al,Mg)2(F,OH)6 · H2O |
| Al | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Al | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Al | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Al | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Al | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Al | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Al | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Al | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Apophyllite Group | AB4[Si8O22]X · 8H2O |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Si | ⓘ Dalyite | K2ZrSi6O15 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Epididymite | Na2Be2Si6O15 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Si | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Si | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Si | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Si | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| Si | ⓘ Natrolite | Na2Al2Si3O10 · 2H2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Thorite var. Orangite | Th(SiO4) |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Paragonite | NaAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Si | ⓘ Sepiolite | Mg4(Si6O15)(OH)2 · 6H2O |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zeophyllite | Ca13Si10O28(OH)2F8 · 6H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Si | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Si | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Si | ⓘ Allophane var. Cupro-Allophane | (Al2O3)(SiO2)1.3-2 · 2.5-3H2O |
| Si | ⓘ Forsterite var. Peridot | Mg2SiO4 |
| Si | ⓘ Fayalite-Forsterite Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Si | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Si | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Si | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Schreibersite | (Fe,Ni)3P |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltpentlandite | Co9S8 |
| S | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| S | ⓘ Cosalite | Pb2Bi2S5 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| S | ⓘ Daubréelite | Fe2+Cr23+S4 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Epsomite | MgSO4 · 7H2O |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Galena | PbS |
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Hexahydrite | MgSO4 · 6H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| S | ⓘ Mendozite | NaAl(SO4)2 · 11H2O |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Rozenite | FeSO4 · 4H2O |
| S | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tetradymite | Bi2Te2S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Troilite | FeS |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Dalyite | K2ZrSi6O15 |
| K | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| K | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| K | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| K | ⓘ Muscovite-1M | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite-2M1 | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite var. Carbonate-rich Fluorapatite | Ca5(PO4,CO3)3(F,O) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapophyllite-(K) | KCa4(Si8O20)(F,OH) · 8H2O |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Ca | ⓘ Gearksutite | Ca[Al(F,OH)5(H2O)] |
| Ca | ⓘ Goosecreekite | Ca[Al2Si6O16] · 5H2O |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Heulandite Subgroup | (Na/Ca/K)5-6[Al8-9 Si27-28 O72] · nH2O |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Ca | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ca | ⓘ Anorthite var. Labradorite | (Ca,Na)[Al(Al,Si)Si2O8] |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Pachnolite | NaCa[AlF6] · H2O |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite Subgroup | Ca2XAl2[Si2O6(OH)][SiO4](OH)2A |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Scolecite | CaAl2Si3O10 · 3H2O |
| Ca | ⓘ Stellerite | Ca4(Si28Al8)O72 · 28H2O |
| Ca | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Thomsenolite | NaCa[AlF6] · H2O |
| Ca | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zeophyllite | Ca13Si10O28(OH)2F8 · 6H2O |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ca | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Ca | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Ca | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Sc | Scandium | |
| Sc | ⓘ Bazzite | Be3Sc2(Si6O18) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Ti | ⓘ Kaersutite | NaCa2(Mg3AlTi4+)(Si6Al2)O22O2 |
| Ti | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Lorenzenite | Na2Ti2(Si2O6)O3 |
| Ti | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Ti | ⓘ Ulvöspinel | TiFe22+O4 |
| Ti | ⓘ Amphibole Supergroup var. Uralite | AX2Z5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ti | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Ti | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Ti | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Cr | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Cr | ⓘ Clinochlore var. Chromium-bearing Clinochlore | Mg5(Al,Cr)2Si3O10(OH)8 |
| Cr | ⓘ Uvarovite | Ca3Cr2(SiO4)3 |
| Mn | Manganese | |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Braunite | Mn2+Mn63+(SiO4)O8 |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Mn | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Mn | ⓘ Kupletskite | K2NaMn72+Ti2[Si4O12]2O2(OH)4F |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Zoisite var. Thulite | {Ca2}{Al,Mn33+}(Si2O7)(SiO4)O(OH) |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Aegirine-augite | (NaaCabFec2+Mgd)(Fee3+AlfFeg2+Mgh)Si2O6 |
| Fe | ⓘ Amarantite | Fe23+(SO4)2O · 7H2O |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Copiapite | Fe2+Fe43+(SO4)6(OH)2 · 20H2O |
| Fe | ⓘ Cordierite | (Mg,Fe)2Al3(AlSi5O18) |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Daubréelite | Fe2+Cr23+S4 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | FeAl2(SO4)4 · 22H2O |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
| Fe | ⓘ Narsarsukite | Na2(Ti,Fe3+)Si4(O,F)11 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Fe | ⓘ Saponite | Ca0.25(Mg,Fe)3((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Schreibersite | (Fe,Ni)3P |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Slavíkite | (H3O+)3Mg6Fe15(SO4)21(OH)18 · 98H2O |
| Fe | ⓘ Stilpnomelane | (K,Ca,Na)(Fe,Mg,Al)8(Si,Al)12(O,OH)36 · nH2O |
| Fe | ⓘ Taenite | (Fe,Ni) |
| Fe | ⓘ Troilite | FeS |
| Fe | ⓘ Ulvöspinel | TiFe22+O4 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Co | Cobalt | |
| Co | ⓘ Cobaltpentlandite | Co9S8 |
| Ni | Nickel | |
| Ni | ⓘ Native Iron var. Kamacite | (Fe,Ni) |
| Ni | ⓘ Millerite | NiS |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ni | ⓘ Schreibersite | (Fe,Ni)3P |
| Ni | ⓘ Taenite | (Fe,Ni) |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Cyanotrichite | Cu4Al2(SO4)(OH)12 · 2H2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Sr | Strontium | |
| Sr | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Sr | ⓘ Brewsterite-Sr | Sr(Al2Si6)O16 · 5H2O |
| Sr | ⓘ Heulandite-Sr | (Sr,Na,Ca)5(Si27Al9)O72 · 24H2O |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Gagarinite-(Y) | NaCaYF6 |
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Y | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Zr | ⓘ Dalyite | K2ZrSi6O15 |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Nb | Niobium | |
| Nb | ⓘ Pyrochlore Group var. Ceriopyrochlore (of Hogarth 1977) | A2Nb2(O,OH)6Z |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Janhaugite | (Na,Ca)3(Mn2+,Fe2+)3(Ti,Zr,Nb)2(Si2O7)2O2(OH,F)2 |
| Nb | ⓘ Pyrochlore Group var. Plumbopyrochlore (of Skorobogatova et al.) | A2Nb2(O,OH)6Z |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | ⓘ Rutile var. Niobium-bearing Rutile | (Ti,Nb)O2 |
| Nb | ⓘ Gjerdingenite-Fe | K2Fe2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Nb | ⓘ Gjerdingenite-Mn | K2Mn2+(Nb,Ti)4(Si4O12)2(O,OH)4 · 6H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver | Ag |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Te | Tellurium | |
| Te | ⓘ Tetradymite | Bi2Te2S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ba | ⓘ Brewsterite-Ba | Ba(Al2Si6)O16 · 5H2O |
| Ba | ⓘ Heulandite-Ba | (Ba,Ca,K)5(Si27Al9)O72 · 22H2O |
| Ce | Cerium | |
| Ce | ⓘ Ancylite-(Ce) | CeSr(CO3)2(OH) · H2O |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Chevkinite-(Ce) | Ce4(Ti,Fe2+,Fe3+)5O8(Si2O7)2 |
| Ce | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Synchysite | Ca(Ce/Nd/Y/REE)(CO3)2F |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| W | Tungsten | |
| W | ⓘ Hydrotungstite | WO3 · 2H2O |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cosalite | Pb2Bi2S5 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Kentrolite | Pb2Mn23+(Si2O7)O2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Osarizawaite | Pb(Al2Cu2+)(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Pb | ⓘ Fluorphosphohedyphane | Ca2Pb3(PO4)3F |
| Bi | Bismuth | |
| Bi | ⓘ Cosalite | Pb2Bi2S5 |
| Bi | ⓘ Tetradymite | Bi2Te2S |
| Th | Thorium | |
| Th | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Orangite | Th(SiO4) |
| Th | ⓘ Thorite | Th(SiO4) |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Fossils
There are 88 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 340 |
|---|---|
| Youngest Fossil Listed | 443 Ma (Silurian) |
| Oldest Fossil Listed | 541 Ma (Cambrian) |
| Stratigraphic Units | Click here to view 31 stratigraphic units. |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 88 fossil localities |
- Akershus
- Jevnaker
- Lunner
- Late/Upper Ordovician🐚 Valborgtjern
- Late/Upper Ordovician🐚 048. Southeast of Øyskogtern Lake
- Late/Upper Ordovician🐚 Ballangrud
- Late/Upper Ordovician🐚 forest track between Nerby and Helgehagen
- Late/Upper Ordovician🐚 Haga
- Paleozoic🐚 Kalvsjø
- Late/Upper Ordovician🐚 Kjevlingen
- Late/Upper Ordovician🐚 Korsrud
- Middle Ordovician🐚 Lunder farm
- Ordovician🐚 Lunner
- Late/Upper Ordovician🐚 Lunner Kirkke
- Late/Upper Ordovician🐚 West of Høltjernet
- Late/Upper Ordovician🐚 Åslund
- Innlandet
- Dovre
- Gausdal
- Gjøvik
- Gran
- Late/Upper Ordovician🐚 213. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 221. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 223. Above Øyskogtern Lake
- Late/Upper Ordovician🐚 265. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 268. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 270S southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 282. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 283S. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 285. southwest of Skirstadtjernet
- Late/Upper Ordovician🐚 286. southwest of Skirstadtjernet
- Paleozoic🐚 300 m south of Gran railway station
- Late/Upper Ordovician🐚 315. East of Øyskogtern Lake
- Late/Upper Ordovician🐚 317. East of Øyskogtern Lake
- Late/Upper Ordovician🐚 635. West of Øyskogtern Lake
- Late/Upper Ordovician🐚 between Gamme and Gammeøvre
- Late/Upper Ordovician🐚 Espen
- Late/Upper Ordovician🐚 Gagnum
- Late/Upper Ordovician🐚 Gagnum Farm
- Late/Upper Ordovician🐚 Granset
- Late/Upper Ordovician🐚 Grymyr
- Innlandet
- Gran
- Late/Upper Ordovician🐚 Grånasen
- Middle Ordovician🐚 Gullerud
- Middle Ordovician🐚 Hovstangen
- Paleozoic🐚 Kalvsjo Formation
- Ordovician🐚 Kløvstad in Gran
- Ordovician🐚 Mjør
- Middle Ordovician🐚 Road section at Hvattum
- Late/Upper Ordovician🐚 Rokotjernet
- Ordovician🐚 Røykenvik
- Middle Ordovician🐚 South of Skiaker
- Paleozoic🐚 Stadum
- Ordovician🐚 Sølvsberget
- Ordovician🐚 Tønnerud
- Late/Upper Ordovician🐚 Vien
- Late/Upper Ordovician🐚 Vien Søndre
- Late/Upper Ordovician🐚 W28
- Late/Upper Ordovician🐚 W35
- Late/Upper Ordovician🐚 W517
- Late/Upper Ordovician🐚 W548
- Late/Upper Ordovician🐚 W551
- Late/Upper Ordovician🐚 W554
- Late/Upper Ordovician🐚 W87
- Late/Upper Ordovician🐚 W92N
- Late/Upper Ordovician🐚 W94
- Late/Upper Ordovician🐚 W95
- Nordre Land
- Østre Toten
- Sel
- Søndre Land
- Vang
- Vestre Toten
- Gran
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Oppland |
|---|---|
| Wikidata ID: | Q50617 |
| GeoNames ID: | 3143487 |
Localities in this Region
- Akershus
- ⭔Dovrefjell
- Innlandet
- ⭔Dovre
- ⭔Gausdal
- ⭔Gjøvik
- Gran
- ⭔Lesja
- ⭔Lillehammer
- ⭔Lom
- Innlandet
- Lom
- ⭔Nord-Aurdal
- Nord-Fron
- Østre Toten
- ⭔Øystre Slidre
- Ringebu
- Sel
- ⭔Skjåk
- ⭔Søndre Land
- Sør-Fron
- ⭔Vågå
- ⭔Valdres
- Vang
- Vestre Slidre
- Baklii
- Flyvatnet
- Lomen Hydropower Tunnel
- Nøsen
- Slidrefjorden
- Undisclosed quartz occurrence
- ⭔Vestre Toten
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Baltic Shield
- Sveconorwegian BeltShield
- CaldeonidesOrogenic Belt
Norway
- DovrefjellMountain Range
- JotunheimenNational Park
- NordmarkaWoods
- Oslo Volcanic ProvinceVolcanic Province
- Western Gneiss RegionGeologic Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Gjerdingselva, Lunner, Akershus, Norway